C34H24F3N3O5S2 — CID 16636201
2-[(8S)-8-(4-methoxyphenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide (PubChem CID 16636201) has the molecular formula C34H24F3N3O5S2 and a molecular weight of 675.71 g/mol. Its IUPAC name is 2-[(8S)-8-(4-methoxyphenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(8S)-8-(4-methoxyphenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 16636201 |
| Molecular Formula | C34H24F3N3O5S2 |
| Molecular Weight | 675.71 g/mol |
| Exact Mass | 675.11 |
| IUPAC Name | 2-[(8S)-8-(4-methoxyphenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide |
| SMILES | COc1ccc([C@H]2c3sc(=O)n(CC(=O)Nc4cccc5ccccc45)c3SC3C(=O)N(c4ccccc4C(F)(F)F)C(=O)C32)cc1 |
| InChI | InChI=1S/C34H24F3N3O5S2/c1-45-20-15-13-19(14-16-20)26-27-28(31(43)40(30(27)42)24-12-5-4-10-22(24)34(35,36)37)46-32-29(26)47-33(44)39(32)17-25(41)38-23-11-6-8-18-7-2-3-9-21(18)23/h2-16,26-28H,17H2,1H3,(H,38,41)/t26-,27?,28?/m1/s1 |
| InChIKey | RSFYMSOGIHPYHM-VOYUOQKBSA-N |
| XLogP | 6.52 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.71 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|