C30H19F6N3O4S2 — CID 43848562
N-[2-(trifluoromethyl)phenyl]-2-[5,10,12-trioxo-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 43848562) has the molecular formula C30H19F6N3O4S2 and a molecular weight of 663.62 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)phenyl]-2-[5,10,12-trioxo-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-[2-(trifluoromethyl)phenyl]-2-[5,10,12-trioxo-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 43848562 |
| Molecular Formula | C30H19F6N3O4S2 |
| Molecular Weight | 663.62 g/mol |
| Exact Mass | 663.07 |
| IUPAC Name | N-[2-(trifluoromethyl)phenyl]-2-[5,10,12-trioxo-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1ccccc1)C1C(=O)N(c3ccccc3C(F)(F)F)C(=O)C1S2)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C30H19F6N3O4S2/c31-29(32,33)16-10-4-6-12-18(16)37-20(40)14-38-27-24(45-28(38)43)21(15-8-2-1-3-9-15)22-23(44-27)26(42)39(25(22)41)19-13-7-5-11-17(19)30(34,35)36/h1-13,21-23H,14H2,(H,37,40) |
| InChIKey | FYIREEFGLISLLN-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.62 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|