C33H22F3N3O4S2 — CID 19249608
N-naphthalen-2-yl-2-[(1R,8R,9R)-5,10,12-trioxo-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19249608) has the molecular formula C33H22F3N3O4S2 and a molecular weight of 645.68 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-[(1R,8R,9R)-5,10,12-trioxo-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-naphthalen-2-yl-2-[(1R,8R,9R)-5,10,12-trioxo-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19249608 |
| Molecular Formula | C33H22F3N3O4S2 |
| Molecular Weight | 645.68 g/mol |
| Exact Mass | 645.10 |
| IUPAC Name | N-naphthalen-2-yl-2-[(1R,8R,9R)-5,10,12-trioxo-8-phenyl-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccccc1)[C@@H]1C(=O)N(c3ccccc3C(F)(F)F)C(=O)[C@@H]1S2)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H22F3N3O4S2/c34-33(35,36)22-12-6-7-13-23(22)39-29(41)26-25(19-9-2-1-3-10-19)28-31(44-27(26)30(39)42)38(32(43)45-28)17-24(40)37-21-15-14-18-8-4-5-11-20(18)16-21/h1-16,25-27H,17H2,(H,37,40)/t25-,26-,27+/m0/s1 |
| InChIKey | AAIYKYFKWJRUKR-GMQQYTKMSA-N |
| XLogP | 6.52 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|