C37H30F3N3O4S2 — CID 43848655
2-[8-(4-tert-butylphenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide (PubChem CID 43848655) has the molecular formula C37H30F3N3O4S2 and a molecular weight of 701.79 g/mol. Its IUPAC name is 2-[8-(4-tert-butylphenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[8-(4-tert-butylphenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 43848655 |
| Molecular Formula | C37H30F3N3O4S2 |
| Molecular Weight | 701.79 g/mol |
| Exact Mass | 701.16 |
| IUPAC Name | 2-[8-(4-tert-butylphenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-2-ylacetamide |
| SMILES | CC(C)(C)c1ccc(C2c3sc(=O)n(CC(=O)Nc4ccc5ccccc5c4)c3SC3C(=O)N(c4ccccc4C(F)(F)F)C(=O)C32)cc1 |
| InChI | InChI=1S/C37H30F3N3O4S2/c1-36(2,3)23-15-12-21(13-16-23)28-29-30(33(46)43(32(29)45)26-11-7-6-10-25(26)37(38,39)40)48-34-31(28)49-35(47)42(34)19-27(44)41-24-17-14-20-8-4-5-9-22(20)18-24/h4-18,28-30H,19H2,1-3H3,(H,41,44) |
| InChIKey | LOURSMZEGGSTAI-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.79 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|