C30H18ClF6N3O4S2 — CID 16636039
2-[(8S)-8-(4-chlorophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 16636039) has the molecular formula C30H18ClF6N3O4S2 and a molecular weight of 698.07 g/mol. Its IUPAC name is 2-[(8S)-8-(4-chlorophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(8S)-8-(4-chlorophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 16636039 |
| Molecular Formula | C30H18ClF6N3O4S2 |
| Molecular Weight | 698.07 g/mol |
| Exact Mass | 697.03 |
| IUPAC Name | 2-[(8S)-8-(4-chlorophenyl)-5,10,12-trioxo-11-[2-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@H](c1ccc(Cl)cc1)C1C(=O)N(c3ccccc3C(F)(F)F)C(=O)C1S2)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H18ClF6N3O4S2/c31-16-10-8-14(9-11-16)21-22-23(26(43)40(25(22)42)19-7-2-1-6-18(19)30(35,36)37)45-27-24(21)46-28(44)39(27)13-20(41)38-17-5-3-4-15(12-17)29(32,33)34/h1-12,21-23H,13H2,(H,38,41)/t21-,22?,23?/m1/s1 |
| InChIKey | JHJQOZIEMQNAGT-DDRJZQQSSA-N |
| XLogP | 7.04 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.07 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|