C24H16ClF3N4O5S2 — CID 21227046
8-(4-chlorophenyl)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 21227046) has the molecular formula C24H16ClF3N4O5S2 and a molecular weight of 597.00 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | 8-(4-chlorophenyl)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 21227046 |
| Molecular Formula | C24H16ClF3N4O5S2 |
| Molecular Weight | 597.00 g/mol |
| Exact Mass | 596.02 |
| IUPAC Name | 8-(4-chlorophenyl)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | NC(=O)N1C(=O)C2Sc3c(sc(=O)n3CC(=O)Nc3cccc(C(F)(F)F)c3)C(c3ccc(Cl)cc3)C2C1=O |
| InChI | InChI=1S/C24H16ClF3N4O5S2/c25-12-6-4-10(5-7-12)15-16-17(20(35)32(19(16)34)22(29)36)38-21-18(15)39-23(37)31(21)9-14(33)30-13-3-1-2-11(8-13)24(26,27)28/h1-8,15-17H,9H2,(H2,29,36)(H,30,33) |
| InChIKey | JIVQCYAIJVFYPW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.00 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|