C24H17F3N4O5S2 — CID 43846518
(8R)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide (PubChem CID 43846518) has the molecular formula C24H17F3N4O5S2 and a molecular weight of 562.55 g/mol. Its IUPAC name is (8R)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide.
| Compound Name | (8R)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
|---|---|
| PubChem CID | 43846518 |
| Molecular Formula | C24H17F3N4O5S2 |
| Molecular Weight | 562.55 g/mol |
| Exact Mass | 562.06 |
| IUPAC Name | (8R)-5,10,12-trioxo-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-11-carboxamide |
| SMILES | NC(=O)N1C(=O)C2Sc3c(sc(=O)n3CC(=O)Nc3cccc(C(F)(F)F)c3)[C@@H](c3ccccc3)C2C1=O |
| InChI | InChI=1S/C24H17F3N4O5S2/c25-24(26,27)12-7-4-8-13(9-12)29-14(32)10-30-21-18(38-23(30)36)15(11-5-2-1-3-6-11)16-17(37-21)20(34)31(19(16)33)22(28)35/h1-9,15-17H,10H2,(H2,28,35)(H,29,32)/t15-,16?,17?/m0/s1 |
| InChIKey | BTKLYWOJMYZSGE-GTPINHCMSA-N |
| XLogP | 3.24 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|