C26H22N4O7S2 — CID 18862808
ethyl 4-[[2-[(1S,8R,9S)-11-carbamoyl-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 18862808) has the molecular formula C26H22N4O7S2 and a molecular weight of 566.62 g/mol. Its IUPAC name is ethyl 4-[[2-[(1S,8R,9S)-11-carbamoyl-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1S,8R,9S)-11-carbamoyl-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18862808 |
| Molecular Formula | C26H22N4O7S2 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | ethyl 4-[[2-[(1S,8R,9S)-11-carbamoyl-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccccc2)[C@H]2C(=O)N(C(N)=O)C(=O)[C@H]2S3)cc1 |
| InChI | InChI=1S/C26H22N4O7S2/c1-2-37-24(34)14-8-10-15(11-9-14)28-16(31)12-29-23-20(39-26(29)36)17(13-6-4-3-5-7-13)18-19(38-23)22(33)30(21(18)32)25(27)35/h3-11,17-19H,2,12H2,1H3,(H2,27,35)(H,28,31)/t17-,18+,19-/m0/s1 |
| InChIKey | LNYBNYRXTQTQQC-OTWHNJEPSA-N |
| XLogP | 2.40 |
| TPSA | 157.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|