C32H27N3O7S2 — CID 18862392
ethyl 4-[(1S,8R,9S)-4-(2-anilino-2-oxoethyl)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 18862392) has the molecular formula C32H27N3O7S2 and a molecular weight of 629.72 g/mol. Its IUPAC name is ethyl 4-[(1S,8R,9S)-4-(2-anilino-2-oxoethyl)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1S,8R,9S)-4-(2-anilino-2-oxoethyl)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 18862392 |
| Molecular Formula | C32H27N3O7S2 |
| Molecular Weight | 629.72 g/mol |
| Exact Mass | 629.13 |
| IUPAC Name | ethyl 4-[(1S,8R,9S)-4-(2-anilino-2-oxoethyl)-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](c4ccc(OC)cc4)c4sc(=O)n(CC(=O)Nc5ccccc5)c4S[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C32H27N3O7S2/c1-3-42-31(39)19-9-13-21(14-10-19)35-28(37)25-24(18-11-15-22(41-2)16-12-18)27-30(43-26(25)29(35)38)34(32(40)44-27)17-23(36)33-20-7-5-4-6-8-20/h4-16,24-26H,3,17H2,1-2H3,(H,33,36)/t24-,25+,26-/m0/s1 |
| InChIKey | VNWOXRWIXQMRBV-NXCFDTQHSA-N |
| XLogP | 4.53 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.72 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|