C34H31N3O9S2 — CID 43846221
ethyl 4-[(8R)-8-(3,4-dimethoxyphenyl)-4-[2-(4-methoxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 43846221) has the molecular formula C34H31N3O9S2 and a molecular weight of 689.77 g/mol. Its IUPAC name is ethyl 4-[(8R)-8-(3,4-dimethoxyphenyl)-4-[2-(4-methoxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8R)-8-(3,4-dimethoxyphenyl)-4-[2-(4-methoxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 43846221 |
| Molecular Formula | C34H31N3O9S2 |
| Molecular Weight | 689.77 g/mol |
| Exact Mass | 689.15 |
| IUPAC Name | ethyl 4-[(8R)-8-(3,4-dimethoxyphenyl)-4-[2-(4-methoxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(OC)cc4)[C@@H](c4ccc(OC)c(OC)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C34H31N3O9S2/c1-5-46-33(41)18-6-11-21(12-7-18)37-30(39)27-26(19-8-15-23(44-3)24(16-19)45-4)29-32(47-28(27)31(37)40)36(34(42)48-29)17-25(38)35-20-9-13-22(43-2)14-10-20/h6-16,26-28H,5,17H2,1-4H3,(H,35,38)/t26-,27?,28?/m0/s1 |
| InChIKey | WPFKCZICQQVEMU-XWYKLZMASA-N |
| XLogP | 4.55 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.77 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|