C33H29N3O9S2 — CID 19248184
ethyl 4-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19248184) has the molecular formula C33H29N3O9S2 and a molecular weight of 675.74 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19248184 |
| Molecular Formula | C33H29N3O9S2 |
| Molecular Weight | 675.74 g/mol |
| Exact Mass | 675.13 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](c4ccc(OC)c(OC)c4)c4sc(=O)n(CC(=O)Nc5ccc(O)cc5)c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C33H29N3O9S2/c1-4-45-32(41)17-5-10-20(11-6-17)36-29(39)26-25(18-7-14-22(43-2)23(15-18)44-3)28-31(46-27(26)30(36)40)35(33(42)47-28)16-24(38)34-19-8-12-21(37)13-9-19/h5-15,25-27,37H,4,16H2,1-3H3,(H,34,38)/t25-,26-,27+/m0/s1 |
| InChIKey | NROQRIDDVPZHSP-GMQQYTKMSA-N |
| XLogP | 4.24 |
| TPSA | 153.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.74 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|