C32H26BrN3O8S2 — CID 18862210
ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 18862210) has the molecular formula C32H26BrN3O8S2 and a molecular weight of 724.61 g/mol. Its IUPAC name is ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18862210 |
| Molecular Formula | C32H26BrN3O8S2 |
| Molecular Weight | 724.61 g/mol |
| Exact Mass | 723.03 |
| IUPAC Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-8-(4-hydroxy-3-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccc(O)c(OC)c2)[C@H]2C(=O)N(c4ccc(Br)cc4)C(=O)[C@H]2S3)cc1 |
| InChI | InChI=1S/C32H26BrN3O8S2/c1-3-44-31(41)16-4-9-19(10-5-16)34-23(38)15-35-30-27(46-32(35)42)24(17-6-13-21(37)22(14-17)43-2)25-26(45-30)29(40)36(28(25)39)20-11-7-18(33)8-12-20/h4-14,24-26,37H,3,15H2,1-2H3,(H,34,38)/t24-,25+,26-/m0/s1 |
| InChIKey | BIVZAZPRMYVEQA-NXCFDTQHSA-N |
| XLogP | 5.00 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|