C33H28ClN3O8S2 — CID 16558287
ethyl 4-[[2-[11-(4-chlorophenyl)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 16558287) has the molecular formula C33H28ClN3O8S2 and a molecular weight of 694.19 g/mol. Its IUPAC name is ethyl 4-[[2-[11-(4-chlorophenyl)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[11-(4-chlorophenyl)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16558287 |
| Molecular Formula | C33H28ClN3O8S2 |
| Molecular Weight | 694.19 g/mol |
| Exact Mass | 693.10 |
| IUPAC Name | ethyl 4-[[2-[11-(4-chlorophenyl)-8-(3,4-dimethoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)C(c2ccc(OC)c(OC)c2)C2C(=O)N(c4ccc(Cl)cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C33H28ClN3O8S2/c1-4-45-32(41)17-5-10-20(11-6-17)35-24(38)16-36-31-28(47-33(36)42)25(18-7-14-22(43-2)23(15-18)44-3)26-27(46-31)30(40)37(29(26)39)21-12-8-19(34)9-13-21/h5-15,25-27H,4,16H2,1-3H3,(H,35,38) |
| InChIKey | XPOXAKKFTGWJOR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.19 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|