C32H26ClN3O7S2 — CID 16635003
ethyl 4-[(8S)-4-[2-(4-chloroanilino)-2-oxoethyl]-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 16635003) has the molecular formula C32H26ClN3O7S2 and a molecular weight of 664.16 g/mol. Its IUPAC name is ethyl 4-[(8S)-4-[2-(4-chloroanilino)-2-oxoethyl]-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-4-[2-(4-chloroanilino)-2-oxoethyl]-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 16635003 |
| Molecular Formula | C32H26ClN3O7S2 |
| Molecular Weight | 664.16 g/mol |
| Exact Mass | 663.09 |
| IUPAC Name | ethyl 4-[(8S)-4-[2-(4-chloroanilino)-2-oxoethyl]-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(Cl)cc4)[C@H](c4ccccc4OC)C3C2=O)cc1 |
| InChI | InChI=1S/C32H26ClN3O7S2/c1-3-43-31(40)17-8-14-20(15-9-17)36-28(38)25-24(21-6-4-5-7-22(21)42-2)27-30(44-26(25)29(36)39)35(32(41)45-27)16-23(37)34-19-12-10-18(33)11-13-19/h4-15,24-26H,3,16H2,1-2H3,(H,34,37)/t24-,25?,26?/m1/s1 |
| InChIKey | VPIQJXKHFBRZNJ-JDSVYEKJSA-N |
| XLogP | 5.18 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.16 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|