C33H29N3O7S2 — CID 43846769
ethyl 4-[[2-[8-(2-methoxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 43846769) has the molecular formula C33H29N3O7S2 and a molecular weight of 643.74 g/mol. Its IUPAC name is ethyl 4-[[2-[8-(2-methoxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[8-(2-methoxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43846769 |
| Molecular Formula | C33H29N3O7S2 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.14 |
| IUPAC Name | ethyl 4-[[2-[8-(2-methoxyphenyl)-11-(4-methylphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)C(c2ccccc2OC)C2C(=O)N(c4ccc(C)cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C33H29N3O7S2/c1-4-43-32(40)19-11-13-20(14-12-19)34-24(37)17-35-31-28(45-33(35)41)25(22-7-5-6-8-23(22)42-3)26-27(44-31)30(39)36(29(26)38)21-15-9-18(2)10-16-21/h5-16,25-27H,4,17H2,1-3H3,(H,34,37) |
| InChIKey | DJHFPQOJCODWSS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|