C35H31N3O9S2 — CID 43847339
ethyl 4-[[2-[11-(4-ethoxycarbonylphenyl)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 43847339) has the molecular formula C35H31N3O9S2 and a molecular weight of 701.78 g/mol. Its IUPAC name is ethyl 4-[[2-[11-(4-ethoxycarbonylphenyl)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[11-(4-ethoxycarbonylphenyl)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43847339 |
| Molecular Formula | C35H31N3O9S2 |
| Molecular Weight | 701.78 g/mol |
| Exact Mass | 701.15 |
| IUPAC Name | ethyl 4-[[2-[11-(4-ethoxycarbonylphenyl)-8-(2-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)C(c2ccccc2OC)C2C(=O)N(c4ccc(C(=O)OCC)cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C35H31N3O9S2/c1-4-46-33(42)19-10-14-21(15-11-19)36-25(39)18-37-32-29(49-35(37)44)26(23-8-6-7-9-24(23)45-3)27-28(48-32)31(41)38(30(27)40)22-16-12-20(13-17-22)34(43)47-5-2/h6-17,26-28H,4-5,18H2,1-3H3,(H,36,39) |
| InChIKey | UQPDDIGQSFISJD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|