C33H26F3N3O7S2 — CID 43847382
ethyl 4-[8-(2-methoxyphenyl)-5,10,12-trioxo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 43847382) has the molecular formula C33H26F3N3O7S2 and a molecular weight of 697.71 g/mol. Its IUPAC name is ethyl 4-[8-(2-methoxyphenyl)-5,10,12-trioxo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[8-(2-methoxyphenyl)-5,10,12-trioxo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 43847382 |
| Molecular Formula | C33H26F3N3O7S2 |
| Molecular Weight | 697.71 g/mol |
| Exact Mass | 697.12 |
| IUPAC Name | ethyl 4-[8-(2-methoxyphenyl)-5,10,12-trioxo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccccc4C(F)(F)F)C(c4ccccc4OC)C3C2=O)cc1 |
| InChI | InChI=1S/C33H26F3N3O7S2/c1-3-46-31(43)17-12-14-18(15-13-17)39-28(41)25-24(19-8-4-7-11-22(19)45-2)27-30(47-26(25)29(39)42)38(32(44)48-27)16-23(40)37-21-10-6-5-9-20(21)33(34,35)36/h4-15,24-26H,3,16H2,1-2H3,(H,37,40) |
| InChIKey | YPBYEHLPFZVNAN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|