C32H24F3N3O6S2 — CID 19248168
ethyl 4-[(1R,8R,9R)-5,10,12-trioxo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19248168) has the molecular formula C32H24F3N3O6S2 and a molecular weight of 667.69 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-5,10,12-trioxo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-5,10,12-trioxo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19248168 |
| Molecular Formula | C32H24F3N3O6S2 |
| Molecular Weight | 667.69 g/mol |
| Exact Mass | 667.11 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-5,10,12-trioxo-4-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](c4ccccc4)c4sc(=O)n(CC(=O)Nc5ccccc5C(F)(F)F)c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C32H24F3N3O6S2/c1-2-44-30(42)18-12-14-19(15-13-18)38-27(40)24-23(17-8-4-3-5-9-17)26-29(45-25(24)28(38)41)37(31(43)46-26)16-22(39)36-21-11-7-6-10-20(21)32(33,34)35/h3-15,23-25H,2,16H2,1H3,(H,36,39)/t23-,24-,25+/m0/s1 |
| InChIKey | TVJNQMPCPWFHKF-CCDWMCETSA-N |
| XLogP | 5.54 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|