C31H24BrN3O6S2 — CID 18862208
ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 18862208) has the molecular formula C31H24BrN3O6S2 and a molecular weight of 678.59 g/mol. Its IUPAC name is ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 18862208 |
| Molecular Formula | C31H24BrN3O6S2 |
| Molecular Weight | 678.59 g/mol |
| Exact Mass | 677.03 |
| IUPAC Name | ethyl 4-[[2-[(1S,8R,9S)-11-(4-bromophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccccc2)[C@H]2C(=O)N(c4ccc(Br)cc4)C(=O)[C@H]2S3)cc1 |
| InChI | InChI=1S/C31H24BrN3O6S2/c1-2-41-30(39)18-8-12-20(13-9-18)33-22(36)16-34-29-26(43-31(34)40)23(17-6-4-3-5-7-17)24-25(42-29)28(38)35(27(24)37)21-14-10-19(32)11-15-21/h3-15,23-25H,2,16H2,1H3,(H,33,36)/t23-,24+,25-/m0/s1 |
| InChIKey | LMCVRVYWGRGHFP-GVAUOCQISA-N |
| XLogP | 5.28 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|