C31H24N4O8S2 — CID 103596640
ethyl 4-[[2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 103596640) has the molecular formula C31H24N4O8S2 and a molecular weight of 644.69 g/mol. Its IUPAC name is ethyl 4-[[2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 103596640 |
| Molecular Formula | C31H24N4O8S2 |
| Molecular Weight | 644.69 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | ethyl 4-[[2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@H](c2ccccc2)C2C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C31H24N4O8S2/c1-2-43-30(39)18-8-10-19(11-9-18)32-22(36)16-33-29-26(45-31(33)40)23(17-6-4-3-5-7-17)24-25(44-29)28(38)34(27(24)37)20-12-14-21(15-13-20)35(41)42/h3-15,23-25H,2,16H2,1H3,(H,32,36)/t23-,24?,25?/m1/s1 |
| InChIKey | KYEMJYQYAKNDLL-CZUALIRWSA-N |
| XLogP | 4.43 |
| TPSA | 157.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.69 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|