C31H24N4O9S2 — CID 43846291
ethyl 4-[[2-[(8R)-8-(4-hydroxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 43846291) has the molecular formula C31H24N4O9S2 and a molecular weight of 660.69 g/mol. Its IUPAC name is ethyl 4-[[2-[(8R)-8-(4-hydroxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(8R)-8-(4-hydroxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 43846291 |
| Molecular Formula | C31H24N4O9S2 |
| Molecular Weight | 660.69 g/mol |
| Exact Mass | 660.10 |
| IUPAC Name | ethyl 4-[[2-[(8R)-8-(4-hydroxyphenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccc(O)cc2)C2C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C31H24N4O9S2/c1-2-44-30(40)17-3-7-18(8-4-17)32-22(37)15-33-29-26(46-31(33)41)23(16-5-13-21(36)14-6-16)24-25(45-29)28(39)34(27(24)38)19-9-11-20(12-10-19)35(42)43/h3-14,23-25,36H,2,15H2,1H3,(H,32,37)/t23-,24?,25?/m0/s1 |
| InChIKey | LPLMOCOPEBVYAD-KAVZGVEFSA-N |
| XLogP | 4.13 |
| TPSA | 178.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|