C31H24ClN3O7S2 — CID 19248188
ethyl 4-[(1R,8R,9R)-8-(4-chlorophenyl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 19248188) has the molecular formula C31H24ClN3O7S2 and a molecular weight of 650.13 g/mol. Its IUPAC name is ethyl 4-[(1R,8R,9R)-8-(4-chlorophenyl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1R,8R,9R)-8-(4-chlorophenyl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 19248188 |
| Molecular Formula | C31H24ClN3O7S2 |
| Molecular Weight | 650.13 g/mol |
| Exact Mass | 649.07 |
| IUPAC Name | ethyl 4-[(1R,8R,9R)-8-(4-chlorophenyl)-4-[2-(4-hydroxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@H]3[C@H](c4ccc(Cl)cc4)c4sc(=O)n(CC(=O)Nc5ccc(O)cc5)c4S[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C31H24ClN3O7S2/c1-2-42-30(40)17-5-11-20(12-6-17)35-27(38)24-23(16-3-7-18(32)8-4-16)26-29(43-25(24)28(35)39)34(31(41)44-26)15-22(37)33-19-9-13-21(36)14-10-19/h3-14,23-25,36H,2,15H2,1H3,(H,33,37)/t23-,24-,25+/m0/s1 |
| InChIKey | RDLHATOIHSJYQX-CCDWMCETSA-N |
| XLogP | 4.88 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.13 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|