C31H25ClN4O8S3 — CID 18862468
ethyl 4-[(1S,8R,9S)-8-(4-chlorophenyl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 18862468) has the molecular formula C31H25ClN4O8S3 and a molecular weight of 713.22 g/mol. Its IUPAC name is ethyl 4-[(1S,8R,9S)-8-(4-chlorophenyl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1S,8R,9S)-8-(4-chlorophenyl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 18862468 |
| Molecular Formula | C31H25ClN4O8S3 |
| Molecular Weight | 713.22 g/mol |
| Exact Mass | 712.05 |
| IUPAC Name | ethyl 4-[(1S,8R,9S)-8-(4-chlorophenyl)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](c4ccc(Cl)cc4)c4sc(=O)n(CC(=O)Nc5ccc(S(N)(=O)=O)cc5)c4S[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C31H25ClN4O8S3/c1-2-44-30(40)17-5-11-20(12-6-17)36-27(38)24-23(16-3-7-18(32)8-4-16)26-29(45-25(24)28(36)39)35(31(41)46-26)15-22(37)34-19-9-13-21(14-10-19)47(33,42)43/h3-14,23-25H,2,15H2,1H3,(H,34,37)(H2,33,42,43)/t23-,24+,25-/m0/s1 |
| InChIKey | PZENYEQKIZGHBX-GVAUOCQISA-N |
| XLogP | 3.82 |
| TPSA | 174.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|