C28H20ClFN4O6S3 — CID 43846071
2-[(8R)-11-(4-chlorophenyl)-8-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43846071) has the molecular formula C28H20ClFN4O6S3 and a molecular weight of 659.14 g/mol. Its IUPAC name is 2-[(8R)-11-(4-chlorophenyl)-8-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(8R)-11-(4-chlorophenyl)-8-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43846071 |
| Molecular Formula | C28H20ClFN4O6S3 |
| Molecular Weight | 659.14 g/mol |
| Exact Mass | 658.02 |
| IUPAC Name | 2-[(8R)-11-(4-chlorophenyl)-8-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2ccc(F)cc2)C2C(=O)N(c4ccc(Cl)cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C28H20ClFN4O6S3/c29-15-3-9-18(10-4-15)34-25(36)22-21(14-1-5-16(30)6-2-14)24-27(41-23(22)26(34)37)33(28(38)42-24)13-20(35)32-17-7-11-19(12-8-17)43(31,39)40/h1-12,21-23H,13H2,(H,32,35)(H2,31,39,40)/t21-,22?,23?/m0/s1 |
| InChIKey | RYUDKKQCDLUOQJ-UVKLAMSESA-N |
| XLogP | 3.78 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.14 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|