C30H24ClFN4O4S2 — CID 19249666
N-(4-chlorophenyl)-2-[(1R,8R,9R)-8-[4-(dimethylamino)phenyl]-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19249666) has the molecular formula C30H24ClFN4O4S2 and a molecular weight of 623.13 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(1R,8R,9R)-8-[4-(dimethylamino)phenyl]-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(1R,8R,9R)-8-[4-(dimethylamino)phenyl]-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19249666 |
| Molecular Formula | C30H24ClFN4O4S2 |
| Molecular Weight | 623.13 g/mol |
| Exact Mass | 622.09 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(1R,8R,9R)-8-[4-(dimethylamino)phenyl]-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | CN(C)c1ccc([C@@H]2c3sc(=O)n(CC(=O)Nc4ccc(Cl)cc4)c3S[C@H]3C(=O)N(c4ccc(F)cc4)C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C30H24ClFN4O4S2/c1-34(2)20-11-3-16(4-12-20)23-24-25(28(39)36(27(24)38)21-13-7-18(32)8-14-21)41-29-26(23)42-30(40)35(29)15-22(37)33-19-9-5-17(31)6-10-19/h3-14,23-25H,15H2,1-2H3,(H,33,37)/t23-,24-,25+/m0/s1 |
| InChIKey | GQWVLNTZPCXXJG-CCDWMCETSA-N |
| XLogP | 5.20 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.13 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|