C30H25FN4O5S2 — CID 43848860
2-[8-[4-(dimethylamino)phenyl]-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide (PubChem CID 43848860) has the molecular formula C30H25FN4O5S2 and a molecular weight of 604.69 g/mol. Its IUPAC name is 2-[8-[4-(dimethylamino)phenyl]-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[8-[4-(dimethylamino)phenyl]-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 43848860 |
| Molecular Formula | C30H25FN4O5S2 |
| Molecular Weight | 604.69 g/mol |
| Exact Mass | 604.13 |
| IUPAC Name | 2-[8-[4-(dimethylamino)phenyl]-11-(4-fluorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-hydroxyphenyl)acetamide |
| SMILES | CN(C)c1ccc(C2c3sc(=O)n(CC(=O)Nc4ccc(O)cc4)c3SC3C(=O)N(c4ccc(F)cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C30H25FN4O5S2/c1-33(2)19-9-3-16(4-10-19)23-24-25(28(39)35(27(24)38)20-11-5-17(31)6-12-20)41-29-26(23)42-30(40)34(29)15-22(37)32-18-7-13-21(36)14-8-18/h3-14,23-25,36H,15H2,1-2H3,(H,32,37) |
| InChIKey | SKTNQKRFJRUOSH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 111.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|