C30H25N5O8S3 — CID 43846189
ethyl 4-[(8R)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 43846189) has the molecular formula C30H25N5O8S3 and a molecular weight of 679.76 g/mol. Its IUPAC name is ethyl 4-[(8R)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8R)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 43846189 |
| Molecular Formula | C30H25N5O8S3 |
| Molecular Weight | 679.76 g/mol |
| Exact Mass | 679.09 |
| IUPAC Name | ethyl 4-[(8R)-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(S(N)(=O)=O)cc4)[C@@H](c4cccnc4)C3C2=O)cc1 |
| InChI | InChI=1S/C30H25N5O8S3/c1-2-43-29(39)16-5-9-19(10-6-16)35-26(37)23-22(17-4-3-13-32-14-17)25-28(44-24(23)27(35)38)34(30(40)45-25)15-21(36)33-18-7-11-20(12-8-18)46(31,41)42/h3-14,22-24H,2,15H2,1H3,(H,33,36)(H2,31,41,42)/t22-,23?,24?/m0/s1 |
| InChIKey | ZZTIFDTWZHOYSM-BOMBAVFCSA-N |
| XLogP | 2.56 |
| TPSA | 187.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|