C27H20N6O8S3 — CID 43846309
2-[(8R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43846309) has the molecular formula C27H20N6O8S3 and a molecular weight of 652.69 g/mol. Its IUPAC name is 2-[(8R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(8R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43846309 |
| Molecular Formula | C27H20N6O8S3 |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.05 |
| IUPAC Name | 2-[(8R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2cccnc2)C2C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C27H20N6O8S3/c28-44(40,41)18-9-3-15(4-10-18)30-19(34)13-31-26-23(43-27(31)37)20(14-2-1-11-29-12-14)21-22(42-26)25(36)32(24(21)35)16-5-7-17(8-6-16)33(38)39/h1-12,20-22H,13H2,(H,30,34)(H2,28,40,41)/t20-,21?,22?/m0/s1 |
| InChIKey | MJPHOMJYUURJJW-HWELCPFYSA-N |
| XLogP | 2.29 |
| TPSA | 204.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|