C28H21N5O6S2 — CID 18862539
N-(4-methylphenyl)-2-[(1S,8R,9S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 18862539) has the molecular formula C28H21N5O6S2 and a molecular weight of 587.64 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-[(1S,8R,9S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-methylphenyl)-2-[(1S,8R,9S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 18862539 |
| Molecular Formula | C28H21N5O6S2 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.09 |
| IUPAC Name | N-(4-methylphenyl)-2-[(1S,8R,9S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2cccnc2)[C@H]2C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@H]2S3)cc1 |
| InChI | InChI=1S/C28H21N5O6S2/c1-15-4-6-17(7-5-15)30-20(34)14-31-27-24(41-28(31)37)21(16-3-2-12-29-13-16)22-23(40-27)26(36)32(25(22)35)18-8-10-19(11-9-18)33(38)39/h2-13,21-23H,14H2,1H3,(H,30,34)/t21-,22+,23-/m0/s1 |
| InChIKey | FRWMTAOXMDJOBS-ZRBLBEILSA-N |
| XLogP | 3.96 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|