C29H24N4O5S2 — CID 18862143
N-(4-methoxyphenyl)-2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 18862143) has the molecular formula C29H24N4O5S2 and a molecular weight of 572.67 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 18862143 |
| Molecular Formula | C29H24N4O5S2 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.12 |
| IUPAC Name | N-(4-methoxyphenyl)-2-[(1S,8R,9S)-11-(4-methylphenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | COc1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2cccnc2)[C@H]2C(=O)N(c4ccc(C)cc4)C(=O)[C@H]2S3)cc1 |
| InChI | InChI=1S/C29H24N4O5S2/c1-16-5-9-19(10-6-16)33-26(35)23-22(17-4-3-13-30-14-17)25-28(39-24(23)27(33)36)32(29(37)40-25)15-21(34)31-18-7-11-20(38-2)12-8-18/h3-14,22-24H,15H2,1-2H3,(H,31,34)/t22-,23+,24-/m0/s1 |
| InChIKey | MHXZNUKXIQQRKG-VXNXHJTFSA-N |
| XLogP | 4.06 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|