C28H21FN4O4S2 — CID 43848716
2-[11-(4-fluorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide (PubChem CID 43848716) has the molecular formula C28H21FN4O4S2 and a molecular weight of 560.63 g/mol. Its IUPAC name is 2-[11-(4-fluorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[11-(4-fluorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43848716 |
| Molecular Formula | C28H21FN4O4S2 |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.10 |
| IUPAC Name | 2-[11-(4-fluorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2c3c(sc2=O)C(c2cccnc2)C2C(=O)N(c4ccc(F)cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C28H21FN4O4S2/c1-15-4-8-18(9-5-15)31-20(34)14-32-27-24(39-28(32)37)21(16-3-2-12-30-13-16)22-23(38-27)26(36)33(25(22)35)19-10-6-17(29)7-11-19/h2-13,21-23H,14H2,1H3,(H,31,34) |
| InChIKey | DTEMEAZWMKIXHP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|