C31H21FN4O4S2 — CID 19249867
2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide (PubChem CID 19249867) has the molecular formula C31H21FN4O4S2 and a molecular weight of 596.67 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 19249867 |
| Molecular Formula | C31H21FN4O4S2 |
| Molecular Weight | 596.67 g/mol |
| Exact Mass | 596.10 |
| IUPAC Name | 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccnc1)[C@@H]1C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]1S2)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C31H21FN4O4S2/c32-19-10-12-20(13-11-19)36-28(38)25-24(18-7-4-14-33-15-18)27-30(41-26(25)29(36)39)35(31(40)42-27)16-23(37)34-22-9-3-6-17-5-1-2-8-21(17)22/h1-15,24-26H,16H2,(H,34,37)/t24-,25-,26+/m0/s1 |
| InChIKey | KBSQGKGITBKUDJ-KKUQBAQOSA-N |
| XLogP | 5.03 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|