C32H23N3O4S2 — CID 19249323
N-naphthalen-1-yl-2-[(1R,8R,9R)-5,10,12-trioxo-8,11-diphenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 19249323) has the molecular formula C32H23N3O4S2 and a molecular weight of 577.69 g/mol. Its IUPAC name is N-naphthalen-1-yl-2-[(1R,8R,9R)-5,10,12-trioxo-8,11-diphenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-naphthalen-1-yl-2-[(1R,8R,9R)-5,10,12-trioxo-8,11-diphenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 19249323 |
| Molecular Formula | C32H23N3O4S2 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | N-naphthalen-1-yl-2-[(1R,8R,9R)-5,10,12-trioxo-8,11-diphenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1ccccc1)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]1S2)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C32H23N3O4S2/c36-24(33-23-17-9-13-19-10-7-8-16-22(19)23)18-34-31-28(41-32(34)39)25(20-11-3-1-4-12-20)26-27(40-31)30(38)35(29(26)37)21-14-5-2-6-15-21/h1-17,25-27H,18H2,(H,33,36)/t25-,26-,27+/m0/s1 |
| InChIKey | ODHIJLWNLPLDSW-GMQQYTKMSA-N |
| XLogP | 5.50 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|