C28H18F3N5O6S2 — CID 19248442
2-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 19248442) has the molecular formula C28H18F3N5O6S2 and a molecular weight of 641.61 g/mol. Its IUPAC name is 2-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19248442 |
| Molecular Formula | C28H18F3N5O6S2 |
| Molecular Weight | 641.61 g/mol |
| Exact Mass | 641.07 |
| IUPAC Name | 2-[(1R,8R,9R)-11-(4-nitrophenyl)-5,10,12-trioxo-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccnc1)[C@@H]1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@@H]1S2)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H18F3N5O6S2/c29-28(30,31)17-5-1-2-6-18(17)33-19(37)13-34-26-23(44-27(34)40)20(14-4-3-11-32-12-14)21-22(43-26)25(39)35(24(21)38)15-7-9-16(10-8-15)36(41)42/h1-12,20-22H,13H2,(H,33,37)/t20-,21-,22+/m0/s1 |
| InChIKey | WXQHQYPKAOYFPR-FDFHNCONSA-N |
| XLogP | 4.67 |
| TPSA | 144.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|