C26H23N5O6S2 — CID 43846321
(8R)-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 43846321) has the molecular formula C26H23N5O6S2 and a molecular weight of 565.63 g/mol. Its IUPAC name is (8R)-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8R)-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 43846321 |
| Molecular Formula | C26H23N5O6S2 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.11 |
| IUPAC Name | (8R)-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-8-pyridin-3-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(Cn1c2c(sc1=O)[C@@H](c1cccnc1)C1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C1S2)N1CCCCC1 |
| InChI | InChI=1S/C26H23N5O6S2/c32-18(28-11-2-1-3-12-28)14-29-25-22(39-26(29)35)19(15-5-4-10-27-13-15)20-21(38-25)24(34)30(23(20)33)16-6-8-17(9-7-16)31(36)37/h4-10,13,19-21H,1-3,11-12,14H2/t19-,20?,21?/m0/s1 |
| InChIKey | CTOGBLGVVQHUMH-MWXLCCTBSA-N |
| XLogP | 3.02 |
| TPSA | 135.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|