C29H28N4O8S2 — CID 19248394
(1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19248394) has the molecular formula C29H28N4O8S2 and a molecular weight of 624.70 g/mol. Its IUPAC name is (1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19248394 |
| Molecular Formula | C29H28N4O8S2 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.13 |
| IUPAC Name | (1R,8R,9R)-8-(3,4-dimethoxyphenyl)-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | COc1ccc([C@@H]2c3sc(=O)n(CC(=O)N4CCCCC4)c3S[C@H]3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)[C@@H]23)cc1OC |
| InChI | InChI=1S/C29H28N4O8S2/c1-40-19-11-6-16(14-20(19)41-2)22-23-24(27(36)32(26(23)35)17-7-9-18(10-8-17)33(38)39)42-28-25(22)43-29(37)31(28)15-21(34)30-12-4-3-5-13-30/h6-11,14,22-24H,3-5,12-13,15H2,1-2H3/t22-,23-,24+/m0/s1 |
| InChIKey | AEWFAPHJBZCSRD-KMDXXIMOSA-N |
| XLogP | 3.64 |
| TPSA | 141.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|