C31H33N5O6S2 — CID 16963629
(8S)-8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 16963629) has the molecular formula C31H33N5O6S2 and a molecular weight of 635.77 g/mol. Its IUPAC name is (8S)-8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 16963629 |
| Molecular Formula | C31H33N5O6S2 |
| Molecular Weight | 635.77 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | (8S)-8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-4-(2-oxo-2-piperidin-1-ylethyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | CCN(CC)c1ccc([C@H]2c3sc(=O)n(CC(=O)N4CCCCC4)c3SC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C31H33N5O6S2/c1-3-32(4-2)20-10-8-19(9-11-20)24-25-26(29(39)35(28(25)38)21-12-14-22(15-13-21)36(41)42)43-30-27(24)44-31(40)34(30)18-23(37)33-16-6-5-7-17-33/h8-15,24-26H,3-7,16-18H2,1-2H3/t24-,25?,26?/m1/s1 |
| InChIKey | DENIKBHJOLMMCR-JDSVYEKJSA-N |
| XLogP | 4.47 |
| TPSA | 126.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|