C36H31N5O6S2 — CID 43847651
2-[8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide (PubChem CID 43847651) has the molecular formula C36H31N5O6S2 and a molecular weight of 693.81 g/mol. Its IUPAC name is 2-[8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 43847651 |
| Molecular Formula | C36H31N5O6S2 |
| Molecular Weight | 693.81 g/mol |
| Exact Mass | 693.17 |
| IUPAC Name | 2-[8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-naphthalen-1-ylacetamide |
| SMILES | CCN(CC)c1ccc(C2c3sc(=O)n(CC(=O)Nc4cccc5ccccc45)c3SC3C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C36H31N5O6S2/c1-3-38(4-2)23-14-12-22(13-15-23)29-30-31(34(44)40(33(30)43)24-16-18-25(19-17-24)41(46)47)48-35-32(29)49-36(45)39(35)20-28(42)37-27-11-7-9-21-8-5-6-10-26(21)27/h5-19,29-31H,3-4,20H2,1-2H3,(H,37,42) |
| InChIKey | PGAXOXOVBFUMND-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.81 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|