C35H33N5O8S2 — CID 16963619
ethyl 4-[[2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 16963619) has the molecular formula C35H33N5O8S2 and a molecular weight of 715.81 g/mol. Its IUPAC name is ethyl 4-[[2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16963619 |
| Molecular Formula | C35H33N5O8S2 |
| Molecular Weight | 715.81 g/mol |
| Exact Mass | 715.18 |
| IUPAC Name | ethyl 4-[[2-[(8S)-8-[4-(diethylamino)phenyl]-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@H](c2ccc(N(CC)CC)cc2)C2C(=O)N(c4ccc([N+](=O)[O-])cc4)C(=O)C2S3)cc1 |
| InChI | InChI=1S/C35H33N5O8S2/c1-4-37(5-2)23-13-9-20(10-14-23)27-28-29(32(43)39(31(28)42)24-15-17-25(18-16-24)40(46)47)49-33-30(27)50-35(45)38(33)19-26(41)36-22-11-7-21(8-12-22)34(44)48-6-3/h7-18,27-29H,4-6,19H2,1-3H3,(H,36,41)/t27-,28?,29?/m1/s1 |
| InChIKey | YDZTXYPKIQCDJY-JMYZALGVSA-N |
| XLogP | 5.28 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.81 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|