C35H35N5O8S3 — CID 43847350
ethyl 4-[8-[4-(diethylamino)phenyl]-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 43847350) has the molecular formula C35H35N5O8S3 and a molecular weight of 749.89 g/mol. Its IUPAC name is ethyl 4-[8-[4-(diethylamino)phenyl]-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[8-[4-(diethylamino)phenyl]-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 43847350 |
| Molecular Formula | C35H35N5O8S3 |
| Molecular Weight | 749.89 g/mol |
| Exact Mass | 749.16 |
| IUPAC Name | ethyl 4-[8-[4-(diethylamino)phenyl]-5,10,12-trioxo-4-[2-oxo-2-(4-sulfamoylanilino)ethyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(S(N)(=O)=O)cc4)C(c4ccc(N(CC)CC)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C35H35N5O8S3/c1-4-38(5-2)23-13-7-20(8-14-23)27-28-29(32(43)40(31(28)42)24-15-9-21(10-16-24)34(44)48-6-3)49-33-30(27)50-35(45)39(33)19-26(41)37-22-11-17-25(18-12-22)51(36,46)47/h7-18,27-29H,4-6,19H2,1-3H3,(H,37,41)(H2,36,46,47) |
| InChIKey | IZYBGLZKKLABJG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 178.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|