C34H32N4O7S2 — CID 43847370
ethyl 4-[8-[4-(dimethylamino)phenyl]-4-[2-(4-methoxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 43847370) has the molecular formula C34H32N4O7S2 and a molecular weight of 672.79 g/mol. Its IUPAC name is ethyl 4-[8-[4-(dimethylamino)phenyl]-4-[2-(4-methoxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[8-[4-(dimethylamino)phenyl]-4-[2-(4-methoxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 43847370 |
| Molecular Formula | C34H32N4O7S2 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.17 |
| IUPAC Name | ethyl 4-[8-[4-(dimethylamino)phenyl]-4-[2-(4-methoxyanilino)-2-oxoethyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(OC)cc4)C(c4ccc(N(C)C)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C34H32N4O7S2/c1-5-45-33(42)20-8-14-23(15-9-20)38-30(40)27-26(19-6-12-22(13-7-19)36(2)3)29-32(46-28(27)31(38)41)37(34(43)47-29)18-25(39)35-21-10-16-24(44-4)17-11-21/h6-17,26-28H,5,18H2,1-4H3,(H,35,39) |
| InChIKey | HMZADDQNICSCRS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|