C33H29N3O8S2 — CID 43846222
ethyl 4-[(8R)-4-[2-(4-methoxyanilino)-2-oxoethyl]-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 43846222) has the molecular formula C33H29N3O8S2 and a molecular weight of 659.74 g/mol. Its IUPAC name is ethyl 4-[(8R)-4-[2-(4-methoxyanilino)-2-oxoethyl]-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8R)-4-[2-(4-methoxyanilino)-2-oxoethyl]-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 43846222 |
| Molecular Formula | C33H29N3O8S2 |
| Molecular Weight | 659.74 g/mol |
| Exact Mass | 659.14 |
| IUPAC Name | ethyl 4-[(8R)-4-[2-(4-methoxyanilino)-2-oxoethyl]-8-(4-methoxyphenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(OC)cc4)[C@@H](c4ccc(OC)cc4)C3C2=O)cc1 |
| InChI | InChI=1S/C33H29N3O8S2/c1-4-44-32(40)19-5-11-21(12-6-19)36-29(38)26-25(18-7-13-22(42-2)14-8-18)28-31(45-27(26)30(36)39)35(33(41)46-28)17-24(37)34-20-9-15-23(43-3)16-10-20/h5-16,25-27H,4,17H2,1-3H3,(H,34,37)/t25-,26?,27?/m0/s1 |
| InChIKey | YHOMQHDKSVWLOH-JRFCFUNGSA-N |
| XLogP | 4.54 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.74 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|