C30H25N3O7S3 — CID 19248910
ethyl 4-[[2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 19248910) has the molecular formula C30H25N3O7S3 and a molecular weight of 635.75 g/mol. Its IUPAC name is ethyl 4-[[2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19248910 |
| Molecular Formula | C30H25N3O7S3 |
| Molecular Weight | 635.75 g/mol |
| Exact Mass | 635.09 |
| IUPAC Name | ethyl 4-[[2-[(1R,8R,9R)-11-(4-methoxyphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2cccs2)[C@@H]2C(=O)N(c4ccc(OC)cc4)C(=O)[C@@H]2S3)cc1 |
| InChI | InChI=1S/C30H25N3O7S3/c1-3-40-29(37)16-6-8-17(9-7-16)31-21(34)15-32-28-25(43-30(32)38)22(20-5-4-14-41-20)23-24(42-28)27(36)33(26(23)35)18-10-12-19(39-2)13-11-18/h4-14,22-24H,3,15H2,1-2H3,(H,31,34)/t22-,23-,24+/m0/s1 |
| InChIKey | GWMOTYDJJXJGPA-KMDXXIMOSA-N |
| XLogP | 4.59 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.75 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|