C32H27N3O8S3 — CID 19248100
ethyl 4-[[2-[(1R,8R,9R)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate (PubChem CID 19248100) has the molecular formula C32H27N3O8S3 and a molecular weight of 677.78 g/mol. Its IUPAC name is ethyl 4-[[2-[(1R,8R,9R)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1R,8R,9R)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 19248100 |
| Molecular Formula | C32H27N3O8S3 |
| Molecular Weight | 677.78 g/mol |
| Exact Mass | 677.10 |
| IUPAC Name | ethyl 4-[[2-[(1R,8R,9R)-11-(4-ethoxycarbonylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cn2c3c(sc2=O)[C@@H](c2cccs2)[C@@H]2C(=O)N(c4ccc(C(=O)OCC)cc4)C(=O)[C@@H]2S3)cc1 |
| InChI | InChI=1S/C32H27N3O8S3/c1-3-42-30(39)17-7-11-19(12-8-17)33-22(36)16-34-29-26(46-32(34)41)23(21-6-5-15-44-21)24-25(45-29)28(38)35(27(24)37)20-13-9-18(10-14-20)31(40)43-4-2/h5-15,23-25H,3-4,16H2,1-2H3,(H,33,36)/t23-,24-,25+/m0/s1 |
| InChIKey | SXMSOABREVCHMB-CCDWMCETSA-N |
| XLogP | 4.76 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|