C27H20ClN3O4S3 — CID 43845772
N-(4-chlorophenyl)-2-[(8R)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide (PubChem CID 43845772) has the molecular formula C27H20ClN3O4S3 and a molecular weight of 582.13 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(8R)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(8R)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
|---|---|
| PubChem CID | 43845772 |
| Molecular Formula | C27H20ClN3O4S3 |
| Molecular Weight | 582.13 g/mol |
| Exact Mass | 581.03 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(8R)-11-(4-methylphenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)C3Sc4c(sc(=O)n4CC(=O)Nc4ccc(Cl)cc4)[C@@H](c4cccs4)C3C2=O)cc1 |
| InChI | InChI=1S/C27H20ClN3O4S3/c1-14-4-10-17(11-5-14)31-24(33)21-20(18-3-2-12-36-18)23-26(37-22(21)25(31)34)30(27(35)38-23)13-19(32)29-16-8-6-15(28)7-9-16/h2-12,20-22H,13H2,1H3,(H,29,32)/t20-,21?,22?/m0/s1 |
| InChIKey | HVZUCLZHHGUFTL-HWELCPFYSA-N |
| XLogP | 5.37 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.13 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|