C26H18FN3O4S3 — CID 43848689
2-[11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide (PubChem CID 43848689) has the molecular formula C26H18FN3O4S3 and a molecular weight of 551.65 g/mol. Its IUPAC name is 2-[11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide.
| Compound Name | 2-[11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 43848689 |
| Molecular Formula | C26H18FN3O4S3 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.04 |
| IUPAC Name | 2-[11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]-N-phenylacetamide |
| SMILES | O=C(Cn1c2c(sc1=O)C(c1cccs1)C1C(=O)N(c3ccc(F)cc3)C(=O)C1S2)Nc1ccccc1 |
| InChI | InChI=1S/C26H18FN3O4S3/c27-14-8-10-16(11-9-14)30-23(32)20-19(17-7-4-12-35-17)22-25(36-21(20)24(30)33)29(26(34)37-22)13-18(31)28-15-5-2-1-3-6-15/h1-12,19-21H,13H2,(H,28,31) |
| InChIKey | YCEYWMSLIHTVSA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|