C29H22FN3O6S3 — CID 18862434
ethyl 4-[(1S,8R,9S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 18862434) has the molecular formula C29H22FN3O6S3 and a molecular weight of 623.71 g/mol. Its IUPAC name is ethyl 4-[(1S,8R,9S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(1S,8R,9S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 18862434 |
| Molecular Formula | C29H22FN3O6S3 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.07 |
| IUPAC Name | ethyl 4-[(1S,8R,9S)-4-[2-(4-fluoroanilino)-2-oxoethyl]-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)[C@@H]3[C@H](c4cccs4)c4sc(=O)n(CC(=O)Nc5ccc(F)cc5)c4S[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C29H22FN3O6S3/c1-2-39-28(37)15-5-11-18(12-6-15)33-25(35)22-21(19-4-3-13-40-19)24-27(41-23(22)26(33)36)32(29(38)42-24)14-20(34)31-17-9-7-16(30)8-10-17/h3-13,21-23H,2,14H2,1H3,(H,31,34)/t21-,22+,23-/m0/s1 |
| InChIKey | VTZYZFUETUHQJK-ZRBLBEILSA-N |
| XLogP | 4.72 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|