C22H17FN2O5S3 — CID 19249855
ethyl 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 19249855) has the molecular formula C22H17FN2O5S3 and a molecular weight of 504.59 g/mol. Its IUPAC name is ethyl 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 19249855 |
| Molecular Formula | C22H17FN2O5S3 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | ethyl 2-[(1R,8R,9R)-11-(4-fluorophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@@H](c1cccs1)[C@@H]1C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]1S2 |
| InChI | InChI=1S/C22H17FN2O5S3/c1-2-30-14(26)10-24-21-18(33-22(24)29)15(13-4-3-9-31-13)16-17(32-21)20(28)25(19(16)27)12-7-5-11(23)6-8-12/h3-9,15-17H,2,10H2,1H3/t15-,16-,17+/m0/s1 |
| InChIKey | QYHDYNNLGBXEJU-YESZJQIVSA-N |
| XLogP | 3.47 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|