C22H17N3O7S3 — CID 16963698
ethyl 2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 16963698) has the molecular formula C22H17N3O7S3 and a molecular weight of 531.59 g/mol. Its IUPAC name is ethyl 2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 16963698 |
| Molecular Formula | C22H17N3O7S3 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | ethyl 2-[(8S)-11-(4-nitrophenyl)-5,10,12-trioxo-8-thiophen-2-yl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@H](c1cccs1)C1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C1S2 |
| InChI | InChI=1S/C22H17N3O7S3/c1-2-32-14(26)10-23-21-18(35-22(23)29)15(13-4-3-9-33-13)16-17(34-21)20(28)24(19(16)27)11-5-7-12(8-6-11)25(30)31/h3-9,15-17H,2,10H2,1H3/t15-,16?,17?/m1/s1 |
| InChIKey | ZHCAWUPJKAZBQT-KLAILNCOSA-N |
| XLogP | 3.24 |
| TPSA | 128.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|