C24H17Cl2N3O7S2 — CID 16963699
ethyl 2-[(8S)-8-(2,3-dichlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate (PubChem CID 16963699) has the molecular formula C24H17Cl2N3O7S2 and a molecular weight of 594.45 g/mol. Its IUPAC name is ethyl 2-[(8S)-8-(2,3-dichlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate.
| Compound Name | ethyl 2-[(8S)-8-(2,3-dichlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
|---|---|
| PubChem CID | 16963699 |
| Molecular Formula | C24H17Cl2N3O7S2 |
| Molecular Weight | 594.45 g/mol |
| Exact Mass | 592.99 |
| IUPAC Name | ethyl 2-[(8S)-8-(2,3-dichlorophenyl)-11-(4-nitrophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-4-yl]acetate |
| SMILES | CCOC(=O)Cn1c2c(sc1=O)[C@H](c1cccc(Cl)c1Cl)C1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C1S2 |
| InChI | InChI=1S/C24H17Cl2N3O7S2/c1-2-36-15(30)10-27-23-20(38-24(27)33)16(13-4-3-5-14(25)18(13)26)17-19(37-23)22(32)28(21(17)31)11-6-8-12(9-7-11)29(34)35/h3-9,16-17,19H,2,10H2,1H3/t16-,17?,19?/m1/s1 |
| InChIKey | UPZPRYNESNMXMP-LRYGQEGESA-N |
| XLogP | 4.48 |
| TPSA | 128.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|